| Product Name | Decanoic acid, mixed esters with neopentyl glycol and octanoic acid |
| CAS No. | 70693-32-2 |
| Synonyms | Neopentyl glycol dicaprylate/dicaprate; Octanoic acid, mixed esters with neopentyl glycol and decanoic acid; Decanoic acid mixed esters with neopentyl glycol and octanoic acid; Neopentyl glycol, esters with caprylic acid and capric acid; decanoic acid,2,2-dimethylpropane-1,3-diol,octanoic acid |
| InChI | InChI=1/C10H20O2.C8H16O2.C5H12O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-5(2,3-6)4-7/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-7H,3-4H2,1-2H3 |
| Molecular Formula | C23H48O6 |
| Molecular Weight | 420.6236 |
| Boiling point | 269.6°C at 760 mmHg |
| Flash point | 121.8°C |
70693-32-2 decanoic acid, mixed esters with neopentyl glycol and octanoic acid
service@apichina.com