| Product Name | Decanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol 2-ethylhexanoate octanoate |
| CAS No. | 68130-25-6 |
| Synonyms | Pentaerythritol 2-ethylhexanoate octanoate decanoate; Pentaerythritol, 2-ethylhexanoic acid,caprylic acid, capric acid mixed ester; 2,2-bis(hydroxymethyl)propane-1,3-diol; 2-ethylhexanoic acid; nonanoic acid; octanoic acid |
| InChI | InChI=1/C9H18O2.2C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9(10)11;1-3-5-6-7(4-2)8(9)10;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-8H2,1H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| Molecular Formula | C30H62O10 |
| Molecular Weight | 582.8073 |
| Boiling point | 254.9°C at 760 mmHg |
| Flash point | 114.9°C |
68130-25-6 decanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol 2-ethylhexanoate octanoa
service@apichina.com