| Product Name | decanoic acid, compound with morpholine (1:1) |
| CAS No. | 20599-77-3 |
| Synonyms | Decanoic acid, compd. with morpholine (1:1); Capric acid, morpholine salt; Decanoic acid, compound with morpholine (1:1); decanoic acid - morpholine (1:1) |
| InChI | InChI=1/C10H20O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-6-4-2-5-1/h2-9H2,1H3,(H,11,12);5H,1-4H2 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.385 |
| Boiling point | 269.6°C at 760 mmHg |
| Flash point | 121.8°C |
20599-77-3 decanoic acid, compound with morpholine (1:1)
service@apichina.com