| Product Name | decanoic acid, compound with dibutylamine (1:1) |
| CAS No. | 29425-97-6 |
| Synonyms | Decanoic acid, compd. with N-butyl-1-butanamine (1:1); Dibutylamine, decanoic acid salt; Decanoic acid, compound with dibutylamine (1:1); decanoic acid - N-butylbutan-1-amine (1:1) |
| InChI | InChI=1/C10H20O2.C8H19N/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-5-7-9-8-6-4-2/h2-9H2,1H3,(H,11,12);9H,3-8H2,1-2H3 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.5078 |
| Boiling point | 269.6°C at 760 mmHg |
| Flash point | 121.8°C |
29425-97-6 decanoic acid, compound with dibutylamine (1:1)
service@apichina.com