| Product Name | Decafluorobenzophenone |
| CAS No. | 853-39-4 |
| InChI | InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
| Molecular Formula | C13F10O |
| Molecular Weight | 362.12 |
| Melting point | 92-94℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
853-39-4 decafluorobenzophenone
service@apichina.com