| Product Name | D-Tryptophanol oxalate |
| CAS No. | 58889-66-0 |
| Synonyms | (R)-beta-Amino-1H-indole-3-propanol oxalate; (2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-aminium |
| InChI | InChI=1/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/p+1/t9-/m1/s1 |
| Molecular Formula | C11H15N2O |
| Molecular Weight | 191.2491 |
| Melting point | 205-208℃ |
| Boiling point | 444.2°C at 760 mmHg |
| Flash point | 222.5°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
58889-66-0 d-tryptophanol oxalate
service@apichina.com