| Product Name | D(-)-Threoninol |
| CAS No. | 44520-55-0 |
| Synonyms | (2R,3R)-2-Amino-1,3-butanediol; D-Threoninol; (2R,3R)-1,3-dihydroxybutan-2-aminium; (2S,3S)-1,3-dihydroxybutan-2-aminium; (2S,3S)-2-aminobutane-1,3-diol |
| InChI | InChI=1/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.1356 |
| Density | 1.118g/cm3 |
| Melting point | 57.5-61.5℃ |
| Boiling point | 257.8°C at 760 mmHg |
| Flash point | 109.7°C |
| Refractive index | 1.488 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
44520-55-0 d(-)-threoninol
service@apichina.com