| Product Name | D(+)-Methioninol |
| CAS No. | 87206-44-8 |
| Synonyms | (R)-2-Amino-4-methylmercapto-1-butanol; D-Methioninol; (2R)-1-hydroxy-4-(methylsulfanyl)butan-2-aminium; (2R)-2-amino-4-(methylsulfanyl)butan-1-ol |
| InChI | InChI=1/C5H13NOS/c1-8-3-2-5(6)4-7/h5,7H,2-4,6H2,1H3/t5-/m1/s1 |
| Molecular Formula | C5H13NOS |
| Molecular Weight | 135.2278 |
| Density | 1.068g/cm3 |
| Melting point | 31-36℃ |
| Boiling point | 270.2°C at 760 mmHg |
| Flash point | 117.2°C |
| Refractive index | 1.516 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
87206-44-8 d(+)-methioninol
service@apichina.com