| Product Name | D-Menthol |
| CAS No. | 15356-60-2 |
| Synonyms | (1S,2R,5S)-(+)-Menthol; (1S,2R,5S)-2-Isopropyl-5-methylcyclohexanol; (1S,2R,5S)-5-methyl-2-(propan-2-yl)cyclohexanol; (1S,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanol; (+)-menthol |
| InChI | InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.2652 |
| Density | 0.89g/cm3 |
| Melting point | 43-44℃ |
| Boiling point | 215.4°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.457 |
| Risk Codes | R37/38:Irritating to respiratory system and skin.; R41:Risks of serious damage to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
15356-60-2 d-menthol
service@apichina.com