| Product Name | D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1) |
| CAS No. | 5743-34-0 |
| Synonyms | Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
| InChI | InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
| Molecular Formula | C6H11BO8 |
| Molecular Weight | 221.9577 |
| Density | 1.68g/cm3 |
| Boiling point | 530.9°C at 760 mmHg |
| Flash point | 274.9°C |
| Refractive index | 1.558 |
5743-34-0 d-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
service@apichina.com