| Product Name | Cyclopropylacetic acid |
| CAS No. | 5239-82-7 |
| Synonyms | Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
| InChI | InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
| Molecular Formula | C8H20B2N6S |
| Molecular Weight | 253.9716 |
| Density | 1.16g/cm3 |
| Boiling point | 293°C at 760 mmHg |
| Flash point | 131°C |
| Refractive index | 1.584 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5239-82-7 cyclopropylacetic acid
service@apichina.com