| Product Name | Cyclopropyl diphenyl carbinol |
| CAS No. | 5785-66-0 |
| Synonyms | alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
| InChI | InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.2658 |
| Density | 1.16g/cm3 |
| Melting point | 82-85℃ |
| Boiling point | 419°C at 760 mmHg |
| Flash point | 207.2°C |
| Refractive index | 1.59 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5785-66-0 cyclopropyl diphenyl carbinol
service@apichina.com