| Product Name | Cyclopentylacetyl chloride |
| CAS No. | 1122-99-2 |
| InChI | InChI=1/C7H11ClO/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.6146 |
| Density | 1.087g/cm3 |
| Boiling point | 186°C at 760 mmHg |
| Flash point | 71.1°C |
| Refractive index | 1.465 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1122-99-2 cyclopentylacetyl chloride
service@apichina.com