| Product Name | Cyclooctene oxide |
| CAS No. | 286-62-4 |
| Synonyms | 9-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane; (1R,8S)-9-oxabicyclo[6.1.0]nonane; (1R,8R)-9-oxabicyclo[6.1.0]nonane; (1S,8S)-9-oxabicyclo[6.1.0]nonane |
| InChI | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.1962 |
| Density | 0.958g/cm3 |
| Melting point | 53-56℃ |
| Boiling point | 189.3°C at 760 mmHg |
| Flash point | 56.1°C |
| Refractive index | 1.466 |
| Hazard Symbols | |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
286-62-4 cyclooctene oxide
service@apichina.com