| Product Name | Cyclohexylidenecyanoacetic acid |
| CAS No. | 37107-50-9 |
| Synonyms | Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
| InChI | InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.211g/cm3 |
| Boiling point | 353.9°C at 760 mmHg |
| Flash point | 167.8°C |
| Refractive index | 1.537 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
37107-50-9 cyclohexylidenecyanoacetic acid
service@apichina.com