| Product Name | cyclohexylammonium stearate |
| CAS No. | 15860-21-6 |
| Synonyms | Octadecanoic acid, compd. with cyclohexanamine (1:1) (9CI); Cyclohexylamine stearite; Cyclohexylammonium stearate; Stearic acid, cyclohexylamine salt (6CI); Stearic acid, compd. with cyclohexylamine (1:1); Stearic acid, compd. with cyclohexylamine (7CI); octadecanoic acid - cyclohexanamine (1:1) |
| InChI | InChI=1/C18H36O2.C6H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-6-4-2-1-3-5-6/h2-17H2,1H3,(H,19,20);6H,1-5,7H2 |
| Molecular Formula | C24H49NO2 |
| Molecular Weight | 383.6514 |
| Boiling point | 359.4°C at 760 mmHg |
| Flash point | 162.4°C |
15860-21-6 cyclohexylammonium stearate
service@apichina.com