| Product Name | cyclohexyl(phenyl)methanol |
| CAS No. | 945-49-3 |
| Synonyms | Methanol, cyclohexylphenyl-; 3-06-00-02527 (Beilstein Handbook Reference); BRN 2048295; Cyclohexanemethanol, alpha-phenyl-; Cyclohexylphenylmethanol; NSC 28611; Benzenemethanol, alpha-cyclohexyl- (9CI) |
| InChI | InChI=1/C13H18O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-14H,2,5-6,9-10H2 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.2814 |
| Density | 1.039g/cm3 |
| Melting point | 48℃ |
| Boiling point | 305.1°C at 760 mmHg |
| Flash point | 128.1°C |
| Refractive index | 1.55 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
945-49-3 cyclohexyl(phenyl)methanol
service@apichina.com