| Product Name | Cyclohexyl methacrylamide |
| CAS No. | 2918-67-4 |
| Synonyms | N-Cyclohexyl methacrylamide; N-cyclohexyl-2-methylprop-2-enamide |
| InChI | InChI=1/C10H17NO/c1-8(2)10(12)11-9-6-4-3-5-7-9/h9H,1,3-7H2,2H3,(H,11,12) |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.2481 |
| Density | 0.95g/cm3 |
| Boiling point | 319.2°C at 760 mmHg |
| Flash point | 187.6°C |
| Refractive index | 1.475 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2918-67-4 cyclohexyl methacrylamide
service@apichina.com