| Product Name | cyclohexyl butyrate |
| CAS No. | 1551-44-6 |
| Synonyms | Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
| InChI | InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.2487 |
| Density | 0.94g/cm3 |
| Boiling point | 214.9°C at 760 mmHg |
| Flash point | 78°C |
| Refractive index | 1.449 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1551-44-6 cyclohexyl butyrate
service@apichina.com