| Product Name | Cyclohexyl acrylate |
| CAS No. | 3066-71-5 |
| Synonyms | Cyclohexyl acrylate,(Acrylic acid cyclohexyl ester); Acrylic acid cyclohexyl ester; cyclohexyl prop-2-enoate; 2-cyclohexylprop-2-enoate |
| InChI | InChI=1/C9H14O2/c1-7(9(10)11)8-5-3-2-4-6-8/h8H,1-6H2,(H,10,11)/p-1 |
| Molecular Formula | C9H13O2 |
| Molecular Weight | 153.1989 |
| Boiling point | 283.7°C at 760 mmHg |
| Flash point | 189.9°C |
| Risk Codes | R37/38:Irritating to respiratory system and skin.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
3066-71-5 cyclohexyl acrylate
service@apichina.com