| Product Name | Cyclohexyl 2-chloroacetate |
| CAS No. | 6975-91-3 |
| Synonyms | cyclohexyl chloroacetate |
| InChI | InChI=1/C8H13ClO2/c9-6-8(10)11-7-4-2-1-3-5-7/h7H,1-6H2 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.6406 |
| Density | 1.11g/cm3 |
| Boiling point | 227.4°C at 760 mmHg |
| Flash point | 99.7°C |
| Refractive index | 1.465 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
6975-91-3 cyclohexyl 2-chloroacetate
service@apichina.com