| Product Name | Cyclohexybenzoicacid |
| CAS No. | 20029-52-1 |
| Synonyms | 4-Cyclohexylbenzoic acid; 4-cyclohexylbenzoate |
| InChI | InChI=1/C13H16O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,14,15)/p-1 |
| Molecular Formula | C13H15O2 |
| Molecular Weight | 203.2575 |
| Boiling point | 351.1°C at 760 mmHg |
| Flash point | 163.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20029-52-1 cyclohexybenzoicacid
service@apichina.com