| Product Name | Cyclohexenedicarboxylicacid |
| CAS No. | 2305-26-2 |
| Synonyms | (1R,2S)-Cyclohex-4-ene-1,2-dicarboxylic acid; 4-cyclohexene-1,2-dicarboxylic acid, (1R,2S)-; 4-Cyclohexene-1,2-dicarboxylic acid, (1R,2S)-rel-; 4-Cyclohexene-1,2-dicarboxylic acid, cis-; Cis-4-cyclohexene-1,2-dicarboxylic acid |
| InChI | InChI=1/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6+ |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.1626 |
| Density | 1.369g/cm3 |
| Boiling point | 395.4°C at 760 mmHg |
| Flash point | 207.1°C |
| Refractive index | 1.548 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2305-26-2 cyclohexenedicarboxylicacid
service@apichina.com