| Product Name | Cyclohexano-18-crown-6, mixture of cis andtrans |
| CAS No. | 17454-53-4 |
| Synonyms | Cyclohexano-18-crown-6; hexadecahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine; (16aR,20aR)-hexadecahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine; (16aR,20aS)-hexadecahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine; (16aS,20aS)-hexadecahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine |
| InChI | InChI=1/C16H30O6/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16/h15-16H,1-14H2/t15-,16-/m0/s1 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.4058 |
| Density | 1.002g/cm3 |
| Boiling point | 454.1°C at 760 mmHg |
| Flash point | 185.5°C |
| Refractive index | 1.426 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
17454-53-4 cyclohexano-18-crown-6, mixture of cis andtrans
service@apichina.com