| Product Name | Cyclohexanebutyric acid |
| CAS No. | 4441-63-8 |
| Synonyms | 4-Cyclohexylbutyric acid; cadmium bis(4-cyclohexylbutanoate); sodium 4-cyclohexylbutanoate; lead(2+) bis(4-cyclohexylbutanoate); lithium 4-cyclohexylbutanoate; mercury bis(4-cyclohexylbutanoate); potassium 4-cyclohexylbutanoate; silver(1+) 4-cyclohexylbutanoate; strontium bis(4-cyclohexylbutanoate); magnesium bis(4-cyclohexylbutanoate); 4-cyclohexylbutanoate |
| InChI | InChI=1/C10H18O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H,11,12)/p-1 |
| Molecular Formula | C10H17O2 |
| Molecular Weight | 169.2413 |
| Melting point | 27-31℃ |
| Boiling point | 283.3°C at 760 mmHg |
| Flash point | 138.9°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4441-63-8 cyclohexanebutyric acid
service@apichina.com