| Product Name | Cycloheptylacetic acid |
| CAS No. | 4401-20-1 |
| InChI | InChI=1/C9H16O2/c10-9(11)7-8-5-3-1-2-4-6-8/h8H,1-7H2,(H,10,11) |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.2221 |
| Density | 0.998g/cm3 |
| Boiling point | 268.7°C at 760 mmHg |
| Flash point | 133.2°C |
| Refractive index | 1.464 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4401-20-1 cycloheptylacetic acid
service@apichina.com