| Product Name | Cyanourea, sodium salt |
| CAS No. | 76989-89-4 |
| Synonyms | Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
| InChI | InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
| Molecular Formula | C2H2N3NaO |
| Molecular Weight | 107.0465 |
| Melting point | 300℃ |
| Boiling point | 263.3°C at 760 mmHg |
| Flash point | 113.1°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
76989-89-4 cyanourea, sodium salt
service@apichina.com