| Product Name | Cyanophenylpiperazine |
| CAS No. | 111373-03-6 |
| Synonyms | 1-(2-Cyanophenyl)piperazine; 2-(1-Piperazino)benzonitrile; 2-piperazin-1-ylbenzonitrile |
| InChI | InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.241 |
| Density | 1.16g/cm3 |
| Boiling point | 369.4°C at 760 mmHg |
| Flash point | 177.2°C |
| Refractive index | 1.602 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
111373-03-6 cyanophenylpiperazine
service@apichina.com