| Product Name | cyanomethyl ethanethioate |
| CAS No. | 59463-56-8 |
| Synonyms | S-(cyanomethyl) ethanethioate |
| InChI | InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| Molecular Formula | C4H5NOS |
| Molecular Weight | 115.1536 |
| Density | 1.162g/cm3 |
| Boiling point | 198.1°C at 760 mmHg |
| Flash point | 73.6°C |
| Refractive index | 1.487 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
59463-56-8 cyanomethyl ethanethioate
service@apichina.com