| Product Name | Crotonyl chloride |
| CAS No. | 10487-71-5 |
| Synonyms | 2-Butenoyl chloride; But-2-enoyl chloride |
| InChI | InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
| Molecular Formula | C4H5ClO |
| Molecular Weight | 104.5349 |
| Density | 1.081g/cm3 |
| Boiling point | 124.499°C at 760 mmHg |
| Flash point | 35°C |
| Refractive index | 1.441 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; S28A:After contact with skin, wash immediately with plenty of water.; |
10487-71-5 crotonyl chloride
service@apichina.com