| Product Name | Corynanthine hydrochloride hydrate |
| CAS No. | 123333-62-0 |
| Synonyms | methyl (16beta,17alpha)-17-hydroxyyohimban-16-carboxylate hydrochloride (1:1); methyl (16beta)-17-hydroxyyohimban-16-carboxylate; (16beta,17alpha)-17-hydroxy-16-(methoxycarbonyl)yohimban-4-ium |
| InChI | InChI=1/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/p+1/t12-,15-,17-,18-,19-/m0/s1 |
| Molecular Formula | C21H27N2O3 |
| Molecular Weight | 355.4501 |
| Melting point | 288-290℃ |
| Boiling point | 542.979°C at 760 mmHg |
| Flash point | 282.184°C |
| Hazard Symbols | |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
123333-62-0 corynanthine hydrochloride hydrate
service@apichina.com