| Product Name | Coronene |
| CAS No. | 191-07-1 |
| Synonyms | Hexabenzobenzene; Coronene (purity) |
| InChI | InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| Molecular Formula | C24H12 |
| Molecular Weight | 300.3521 |
| Density | 1.467g/cm3 |
| Melting point | 438-440℃ |
| Boiling point | 525.6°C at 760 mmHg |
| Flash point | 265.2°C |
| Refractive index | 2.139 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
191-07-1 coronene
service@apichina.com
- Next:191-13-9 pyranthrene
- Previous:191-06-0 dibenzo[lm,yz]pyranthrene