| Product Name | Cobalt(II)2,4-pentanedionate |
| CAS No. | 123334-29-2 |
| Synonyms | Cobalt(II) acetylacetonate hydrate; Cobaltacetylacetonatehydratepinkpowder; Bis(acetylacetonato)cobalt(II) hydrate~Bis(2,4-pentanedionato)cobalt(II) hydrate~Cobalt(II) 2,4-pentanedionate hydrate; 2-penten-2-olate, 4-oxo-, (2Z)-, cobalt(2+) salt, hydrate (1:1:1); Cobalt acetylacetonate hydrate |
| InChI | InChI=1/C5H8O2.Co.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/q;+2;/p-1/b4-3-;; |
| Molecular Formula | C5H9CoO3 |
| Molecular Weight | 176.0558 |
| Risk Codes | R22:Harmful if swallowed.; R42/43:May cause sensitization by inhalation and skin contact.; R49:May cause cancer by inhalation.; |
| Safety | S22:Do not inhale dust.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
123334-29-2 cobalt(ii)2,4-pentanedionate
service@apichina.com