| Product Name | (+)-citronellal |
| CAS No. | 2385-77-5 |
| Synonyms | (R)-(+)-Citronellal; (R)-(+)-3,7-Dimethyl-6-octenal |
| InChI | InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| Density | 0.8554 |
| Boiling point | 201-204℃ |
| Flash point | 78℃ |
| Refractive index | 1.4467 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2385-77-5 (+)-citronellal
service@apichina.com