| Product Name | cis-Stilbeneboronic acid diethanolamine cyclic ester |
| CAS No. | 501014-42-2 |
| Synonyms | cis-(1,2-Diphenylethenyl)boronic acid diethanolamine cyclic ester; 2-[(Z)-1,2-diphenylethenyl]-1,3,6,2-dioxazaborocane |
| InChI | InChI=1/C18H20BNO2/c1-3-7-16(8-4-1)15-18(17-9-5-2-6-10-17)19-21-13-11-20-12-14-22-19/h1-10,15,20H,11-14H2/b18-15+ |
| Molecular Formula | C18H20BNO2 |
| Molecular Weight | 293.1679 |
| Density | 1.107g/cm3 |
| Boiling point | 404.11°C at 760 mmHg |
| Flash point | 198.199°C |
| Refractive index | 1.575 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
501014-42-2 cis-stilbeneboronic acid diethanolamine cyclic ester
service@apichina.com