| Product Name | cis-Decahydronaphthalene |
| CAS No. | 493-01-6;91-17-8 |
| Synonyms | cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.2499 |
| Density | 0.873g/cm3 |
| Melting point | -31℃ |
| Boiling point | 190.879°C at 760 mmHg |
| Flash point | 57.222°C |
| Water solubility | 6 mg/L at 20℃ |
| Refractive index | 1.47 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R20:Harmful by inhalation.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
493-01-6;91-17-8 cis-decahydronaphthalene
service@apichina.com