| Product Name | cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
| CAS No. | 3786-91-2 |
| Synonyms | r-1,c-2,c-3,c-4-Cyclopentanetetracarboxylic acid; AI3-50868; 1,2,3,4-Cyclopentanetetracarboxylic acid, (1alpha,2alpha,3alpha,4alpha)-; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylic acid; (1R,2R,3R,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (2R,3S,4R,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name) |
| InChI | InChI=1/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-4/t1-,2+,3+,4- |
| Molecular Formula | C8H4O9 |
| Molecular Weight | 244.1142 |
| Melting point | 192-195℃ |
| Boiling point | 597.011°C at 760 mmHg |
| Flash point | 243.903°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3786-91-2 cis,cis,cis,cis-1,2,3,4-cyclopentanetetracarboxylic acid
service@apichina.com