| Product Name | cis-2,6-Dimethylmorpholine |
| CAS No. | 6485-55-8 |
| Synonyms | (2R,6S)-2,6-dimethylmorpholin-4-ium |
| InChI | InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/p+1/t5-,6+ |
| Molecular Formula | C6H14NO |
| Molecular Weight | 116.1809 |
| Boiling point | 146.6°C at 760 mmHg |
| Flash point | 48.9°C |
| Risk Codes | R10:Flammable.; R21:Harmful in contact with skin.; R37/38:Irritating to respiratory system and skin.; R41:Risks of serious damage to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6485-55-8 cis-2,6-dimethylmorpholine
service@apichina.com