| Product Name | cis-1,2-Cyclohexanedicarboxylic anhydride |
| CAS No. | 85-42-7;13149-00-3 |
| Synonyms | cis-Hexahydrophthalic anhydride; cis-HHPA; hexahydro-2-benzofuran-1,3-dione; (3aR,7aS)-hexahydro-2-benzofuran-1,3-dione; HHPA; Hexahydrophthalic anhydride; 1,2-Cyclohexanedicarboxylic anhydride; cyclohexanedicarboxylic anhydridel; 1,2-cyclohexane-dicarboxylic anhydride, mixture of cis and trans; Cyclohexane-1,2-dicarboxylic anhydride |
| InChI | InChI=1/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h5-6H,1-4H2/t5-,6+ |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.1632 |
| Density | 1.236g/cm3 |
| Melting point | 29-32℃ |
| Boiling point | 283.351°C at 760 mmHg |
| Flash point | 143.909°C |
| Refractive index | 1.502 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R41:Risks of serious damage to eyes.; R42/43:May cause sensitization by inhalation and skin contact.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24:Avoid contact with skin.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
85-42-7;13149-00-3 cis-1,2-cyclohexanedicarboxylic anhydride
service@apichina.com