| Product Name | Cinnamylidenemalonic acid |
| CAS No. | 4472-92-8 |
| Synonyms | 2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
| InChI | InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.1906 |
| Boiling point | 484.6°C at 760 mmHg |
| Flash point | 261°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4472-92-8 cinnamylidenemalonic acid
service@apichina.com