| Product Name | cinnamyl anthranilate |
| CAS No. | 87-29-6 |
| Synonyms | 2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate; 3-phenylprop-2-en-1-yl 2-aminobenzoate; (2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
| InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.2958 |
| Density | 1.178g/cm3 |
| Boiling point | 449.1°C at 760 mmHg |
| Flash point | 269.4°C |
| Refractive index | 1.642 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
87-29-6 cinnamyl anthranilate
service@apichina.com