| Product Name | Cinnamicacid vinylester |
| CAS No. | 3098-92-8 |
| Synonyms | Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate |
| InChI | InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+ |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.1959 |
| Density | 1.075g/cm3 |
| Boiling point | 267°C at 760 mmHg |
| Flash point | 105.9°C |
| Refractive index | 1.566 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3098-92-8 cinnamicacid vinylester
service@apichina.com