| Product Name | Cinnamic acid propyl ester |
| CAS No. | 7778-83-8 |
| Synonyms | Cinnamic acid n-propyl ester; n-Propyl cinnamate,(Cinnamic acid n-propyl ester); n-Propyl cinnamate; propyl 3-phenylprop-2-enoate; propyl (2E)-3-phenylprop-2-enoate |
| InChI | InChI=1/C12H14O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8+ |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.2384 |
| Density | 1.037g/cm3 |
| Boiling point | 286.2°C at 760 mmHg |
| Flash point | 156.1°C |
| Refractive index | 1.543 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
7778-83-8 cinnamic acid propyl ester
service@apichina.com
- Next:7778-85-0 1,2-dimethoxypropane
- Previous:7778-50-9 potassium dichromate