| Product Name | chlorosulfonylacetyl chloride |
| CAS No. | 4025-77-8 |
| Synonyms | Acetyl chloride, 2-(chlorosulfonyl)-; (Chlorosulphonyl)acetyl chloride; Acetyl chloride, (chlorosulfonyl)-; 8-[(2,5-dimethoxyphenyl)carbonyl]-2-[2-methyl-3-(2,4,5-trimethoxyphenyl)acryloyl]-2,8-diazaspiro[4.5]decane |
| InChI | InChI=1/C30H38N2O7/c1-20(15-21-16-26(38-5)27(39-6)18-25(21)37-4)28(33)32-14-11-30(19-32)9-12-31(13-10-30)29(34)23-17-22(35-2)7-8-24(23)36-3/h7-8,15-18H,9-14,19H2,1-6H3 |
| Molecular Formula | C30H38N2O7 |
| Molecular Weight | 538.6319 |
| Density | 1.24g/cm3 |
| Boiling point | 753.9°C at 760 mmHg |
| Flash point | 409.7°C |
| Refractive index | 1.595 |
| Hazard Symbols | |
| Risk Codes | R14:Reacts violently with water.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S8:Keep container dry.; |
4025-77-8 chlorosulfonylacetyl chloride
service@apichina.com