| Product Name | chloroflurenol methyl ester |
| CAS No. | 37339-61-0 |
| Synonyms | Methyl-2,7-dichloro-9-hydroxyfluorene-9-carboxylate, mixt. with methyl 2-chloro-9-hydroxyfluorene-9-carboxylate and methyl 9-hydroxyfluorene-9-carboxylate; 9H-Fluorene-9-carboxylic acid, 2,7-dichloro-9-hydroxy-, methyl ester, mixt. with methyl 2-chlo; 9H-Fluorene-9-carboxylic acid, 2,7-dichloro-9-hydroxy-, methyl ester, mixt. with methyl 2-chloro-9-hydroxy-9H-fluorene-9-carboxylate and methyl 9-hydroxy-9H-fluorene-9-carboxylate |
| InChI | InChI=1/C15H11ClO3/c1-19-14(17)15(18)12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)15/h2-8,18H,1H3 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 |
37339-61-0 chloroflurenol methyl ester
service@apichina.com