| Product Name | Chlorodibromomethane |
| CAS No. | 124-48-1 |
| Synonyms | Dibromochloromethane |
| InChI | InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| Molecular Formula | CHBr2Cl |
| Molecular Weight | 208.2796 |
| Density | 2.504g/cm3 |
| Melting point | -22℃ |
| Boiling point | 117.1°C at 760 mmHg |
| Flash point | 19.8°C |
| Refractive index | 1.561 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R40:Possible risks of irreversible effects.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
124-48-1 chlorodibromomethane
service@apichina.com