| Product Name | chlorocarbonylsulfenyl chloride |
| CAS No. | 2757-23-5 |
| Synonyms | Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
| InChI | InChI=1/CCl2OS/c2-1(4)5-3 |
| Molecular Formula | CCl2OS |
| Molecular Weight | 130.9811 |
| Density | 1.66g/cm3 |
| Boiling point | 98°C at 760 mmHg |
| Flash point | 53.7°C |
| Refractive index | 1.53 |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2757-23-5 chlorocarbonylsulfenyl chloride
service@apichina.com