| Product Name | Chloroacetic anhydride |
| CAS No. | 541-88-8 |
| Synonyms | Chloracetic anhydride; 2-Chloroacetic anhydride; AI3-52321; Acetic acid, chloro-, anhydride; Chloroacetic acid anhydride; Chloroacetyl anhydride; Chloroethanoic anhydride; HSDB 5685; Monochloroacetic acid anhydride; NSC 71207; Sym-dichloroacetic anhydride; alpha,alpha'-Dichloroacetic anhydride; Acetic acid, 2-chloro-, 1,1'-anhydride; methyl 3-chloro-4-fluorobutanoate; (2-chloroacetyl) 2-chloroacetate |
| InChI | InChI=1/C4H4Cl2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
| Molecular Formula | C4H4Cl2O3 |
| Molecular Weight | 170.9788 |
| Density | 1.449g/cm3 |
| Melting point | 54-58℃ |
| Boiling point | 203°C at 760 mmHg |
| Flash point | 82.8°C |
| Refractive index | 1.456 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R35:Causes severe burns.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
541-88-8 chloroacetic anhydride
service@apichina.com