| Product Name | Chlorfenac |
| CAS No. | 85-34-7 |
| Synonyms | 2,3,6-Trichlorophenylacetic acid; Chlorfenac [BSI:ISO]; 2,3,6-TCA; 2,3,6-Trichlorobenzeneacetic acid; 2,3,6-Trichlorophenyl acetic acid; 2,3,6-Trichlorphenylessigsaeure; 2,3,6-Trichlorphenylessigsaeure [German]; 4-09-00-01681 (Beilstein Handbook Reference); Acetic acid, (2,3,6-trichlorophenyl)-; BRN 2113332; Benzeneacetic acid, 2,3,6-trichloro-; Caswell No. 882; EINECS 201-599-3; EPA Pesticide Chemical Code 082601; Fenac; Fenae; Fenatrol; HSDB 3434; Kanepar; Kyselina 2,3,6-trichlorfenyloctova; Kyselina 2,3,6-trichlorfenyloctova [Czech]; NSC 41931; Tri fene; Tri-fen; Trifene; (2,3,6-trichlorophenyl)acetate |
| InChI | InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| Molecular Formula | C8H4Cl3O2 |
| Molecular Weight | 238.4757 |
| Boiling point | 353.5°C at 760 mmHg |
| Flash point | 167.6°C |
| Risk Codes | R22:Harmful if swallowed.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S36:Wear suitable protective clothing.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
85-34-7 chlorfenac
service@apichina.com