| Product Name | Carbonic acid, dithio-, S-(2-aminoethyl) ester, S-ester with 5-mercapt ovaleric acid, hydrochloride |
| CAS No. | 19213-26-4 |
| Synonyms | Carbonic acid, dithio-, S-(2-aminoethyl) ester, S-ester with 5-mercaptovaleric acid, hydrochloride; Dithiocarbonic acid S-(2-aminoethyl) ester S-ester with 5-mercaptovaleric acid hydrochloride; 5-({[(2-aminoethyl)sulfanyl]carbonyl}sulfanyl)pentanoic acid hydrochloride (1:1) |
| InChI | InChI=1/C8H15NO3S2.ClH/c9-4-6-14-8(12)13-5-2-1-3-7(10)11;/h1-6,9H2,(H,10,11);1H |
| Molecular Formula | C8H16ClNO3S2 |
| Molecular Weight | 273.8005 |
| Boiling point | 406.2°C at 760 mmHg |
| Flash point | 199.5°C |
19213-26-4 carbonic acid, dithio-, s-(2-aminoethyl) ester, s-ester with 5-mercapt ovaleric acid, hyd
service@apichina.com